C15H25N3O2S — CID 107162990
1-N-[(1,4-dimethylpiperidin-4-yl)methyl]-4-methylsulfonylbenzene-1,2-diamine (PubChem CID 107162990) has the molecular formula C15H25N3O2S and a molecular weight of 311.45 g/mol. Its IUPAC name is 1-N-[(1,4-dimethylpiperidin-4-yl)methyl]-4-methylsulfonylbenzene-1,2-diamine.
| Compound Name | 1-N-[(1,4-dimethylpiperidin-4-yl)methyl]-4-methylsulfonylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 107162990 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-N-[(1,4-dimethylpiperidin-4-yl)methyl]-4-methylsulfonylbenzene-1,2-diamine |
| SMILES | CN1CCC(C)(CNc2ccc(S(C)(=O)=O)cc2N)CC1 |
| InChI | InChI=1S/C15H25N3O2S/c1-15(6-8-18(2)9-7-15)11-17-14-5-4-12(10-13(14)16)21(3,19)20/h4-5,10,17H,6-9,11,16H2,1-3H3 |
| InChIKey | VNEBNRVGTOSUCA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|