C11H12F2N2O4S — CID 138002921
2-[(3,3-difluorocyclobutyl)amino]-5-sulfamoylbenzoic acid (PubChem CID 138002921) has the molecular formula C11H12F2N2O4S and a molecular weight of 306.29 g/mol. Its IUPAC name is 2-[(3,3-difluorocyclobutyl)amino]-5-sulfamoylbenzoic acid.
| Compound Name | 2-[(3,3-difluorocyclobutyl)amino]-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 138002921 |
| Molecular Formula | C11H12F2N2O4S |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-[(3,3-difluorocyclobutyl)amino]-5-sulfamoylbenzoic acid |
| SMILES | NS(=O)(=O)c1ccc(NC2CC(F)(F)C2)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H12F2N2O4S/c12-11(13)4-6(5-11)15-9-2-1-7(20(14,18)19)3-8(9)10(16)17/h1-3,6,15H,4-5H2,(H,16,17)(H2,14,18,19) |
| InChIKey | QLBQDNKGSUFGSK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |