C10H10BrF3N2O2S — CID 67530049
4-bromo-2-(cyclopropylamino)-6-(trifluoromethyl)benzenesulfonamide (PubChem CID 67530049) has the molecular formula C10H10BrF3N2O2S and a molecular weight of 359.17 g/mol. Its IUPAC name is 4-bromo-2-(cyclopropylamino)-6-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-bromo-2-(cyclopropylamino)-6-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 67530049 |
| Molecular Formula | C10H10BrF3N2O2S |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 4-bromo-2-(cyclopropylamino)-6-(trifluoromethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(NC2CC2)cc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C10H10BrF3N2O2S/c11-5-3-7(10(12,13)14)9(19(15,17)18)8(4-5)16-6-1-2-6/h3-4,6,16H,1-2H2,(H2,15,17,18) |
| InChIKey | WEJQATYZKSYCSH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |