C12H17N3O — CID 80714080
N-(oxolan-3-yl)-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 80714080) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is N-(oxolan-3-yl)-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | N-(oxolan-3-yl)-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 80714080 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N-(oxolan-3-yl)-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | c1nc2c(c(NC3CCOC3)n1)CCCC2 |
| InChI | InChI=1S/C12H17N3O/c1-2-4-11-10(3-1)12(14-8-13-11)15-9-5-6-16-7-9/h8-9H,1-7H2,(H,13,14,15) |
| InChIKey | ZFMZLVHZDIQVAC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |