C8H13N3O — CID 106577304
5-methyl-N-(oxolan-3-yl)-1H-imidazol-2-amine (PubChem CID 106577304) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 5-methyl-N-(oxolan-3-yl)-1H-imidazol-2-amine.
| Compound Name | 5-methyl-N-(oxolan-3-yl)-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 106577304 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 5-methyl-N-(oxolan-3-yl)-1H-imidazol-2-amine |
| SMILES | Cc1cnc(NC2CCOC2)[nH]1 |
| InChI | InChI=1S/C8H13N3O/c1-6-4-9-8(10-6)11-7-2-3-12-5-7/h4,7H,2-3,5H2,1H3,(H2,9,10,11) |
| InChIKey | QNCICRHUEJOFGO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |