C9H13N3O — CID 130628778
N-[(3S)-oxan-3-yl]pyrazin-2-amine (PubChem CID 130628778) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is N-[(3S)-oxan-3-yl]pyrazin-2-amine.
| Compound Name | N-[(3S)-oxan-3-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 130628778 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N-[(3S)-oxan-3-yl]pyrazin-2-amine |
| SMILES | c1cnc(N[C@H]2CCCOC2)cn1 |
| InChI | InChI=1S/C9H13N3O/c1-2-8(7-13-5-1)12-9-6-10-3-4-11-9/h3-4,6,8H,1-2,5,7H2,(H,11,12)/t8-/m0/s1 |
| InChIKey | HJCZNGICYKWGOH-QMMMGPOBSA-N |
| XLogP | 1.07 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |