C7H13N5O — CID 66274730
3-N-(oxan-3-yl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 66274730) has the molecular formula C7H13N5O and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-N-(oxan-3-yl)-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(oxan-3-yl)-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 66274730 |
| Molecular Formula | C7H13N5O |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 3-N-(oxan-3-yl)-1H-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(NC2CCCOC2)n[nH]1 |
| InChI | InChI=1S/C7H13N5O/c8-6-10-7(12-11-6)9-5-2-1-3-13-4-5/h5H,1-4H2,(H4,8,9,10,11,12) |
| InChIKey | RETQGVXHVMLYBP-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |