C11H17N3O2 — CID 63359888
6-methoxy-2-N-(oxan-3-yl)pyridine-2,5-diamine (PubChem CID 63359888) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 6-methoxy-2-N-(oxan-3-yl)pyridine-2,5-diamine.
| Compound Name | 6-methoxy-2-N-(oxan-3-yl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 63359888 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 6-methoxy-2-N-(oxan-3-yl)pyridine-2,5-diamine |
| SMILES | COc1nc(NC2CCCOC2)ccc1N |
| InChI | InChI=1S/C11H17N3O2/c1-15-11-9(12)4-5-10(14-11)13-8-3-2-6-16-7-8/h4-5,8H,2-3,6-7,12H2,1H3,(H,13,14) |
| InChIKey | SLQRVSJPEVHHJK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |