C12H19N3O2 — CID 114240788
6-methoxy-2-N-(3-methyloxan-4-yl)pyridine-2,5-diamine (PubChem CID 114240788) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 6-methoxy-2-N-(3-methyloxan-4-yl)pyridine-2,5-diamine.
| Compound Name | 6-methoxy-2-N-(3-methyloxan-4-yl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 114240788 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 6-methoxy-2-N-(3-methyloxan-4-yl)pyridine-2,5-diamine |
| SMILES | COc1nc(NC2CCOCC2C)ccc1N |
| InChI | InChI=1S/C12H19N3O2/c1-8-7-17-6-5-10(8)14-11-4-3-9(13)12(15-11)16-2/h3-4,8,10H,5-7,13H2,1-2H3,(H,14,15) |
| InChIKey | XSMHGEZYODMWQG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |