C13H16N4O — CID 114241071
N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine (PubChem CID 114241071) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine.
| Compound Name | N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 114241071 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine |
| SMILES | CC1COCCC1Nc1nnc2ccccc2n1 |
| InChI | InChI=1S/C13H16N4O/c1-9-8-18-7-6-10(9)14-13-15-11-4-2-3-5-12(11)16-17-13/h2-5,9-10H,6-8H2,1H3,(H,14,15,17) |
| InChIKey | RWHJFKSBXUZXBX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |