About N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine
N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine (PubChem CID 114241071) has the molecular formula C13H16N4O
and a molecular weight of 244.30 g/mol. Its IUPAC name is N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine.
Molecular Properties
| Compound Name | N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine |
| PubChem CID | 114241071 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine |
| SMILES | CC1COCCC1Nc1nnc2ccccc2n1 |
| InChI | InChI=1S/C13H16N4O/c1-9-8-18-7-6-10(9)14-13-15-11-4-2-3-5-12(11)16-17-13/h2-5,9-10H,6-8H2,1H3,(H,14,15,17) |
| InChIKey | RWHJFKSBXUZXBX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine?
The IUPAC name of N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine (CID 114241071) is N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine.
What is the SMILES notation for N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine?
The canonical SMILES for N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine is CC1COCCC1Nc1nnc2ccccc2n1.
What is the InChIKey of N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine?
The InChIKey is RWHJFKSBXUZXBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O/c1-9-8-18-7-6-10(9)14-13-15-11-4-2-3-5-12(11)16-17-13/h2-5,9-10H,6-8H2,1H3,(H,14,15,17).
What are the key properties of N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine?
N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine has a molecular weight of 244.30 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methyloxan-4-yl)-1,2,4-benzotriazin-3-amine is sourced from PubChem (CID 114241071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).