C10H12N4O3 — CID 135860775
N-(ethoxymethyl)-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine (PubChem CID 135860775) has the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is N-(ethoxymethyl)-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine.
| Compound Name | N-(ethoxymethyl)-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine |
|---|---|
| PubChem CID | 135860775 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | N-(ethoxymethyl)-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine |
| SMILES | CCOCNc1n[n+]([O-])c2ccccc2[n+]1[O-] |
| InChI | InChI=1S/C10H12N4O3/c1-2-17-7-11-10-12-14(16)9-6-4-3-5-8(9)13(10)15/h3-6H,2,7H2,1H3,(H,11,12) |
| InChIKey | QTPHGTXPZIVYIV-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 88.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|