C12H20N4 — CID 79827207
6-N-(2,3-dimethylcyclopentyl)pyridine-2,3,6-triamine (PubChem CID 79827207) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 6-N-(2,3-dimethylcyclopentyl)pyridine-2,3,6-triamine.
| Compound Name | 6-N-(2,3-dimethylcyclopentyl)pyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 79827207 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 6-N-(2,3-dimethylcyclopentyl)pyridine-2,3,6-triamine |
| SMILES | CC1CCC(Nc2ccc(N)c(N)n2)C1C |
| InChI | InChI=1S/C12H20N4/c1-7-3-5-10(8(7)2)15-11-6-4-9(13)12(14)16-11/h4,6-8,10H,3,5,13H2,1-2H3,(H3,14,15,16) |
| InChIKey | SQQJTRGGZRVTPU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |