C11H18N4O — CID 79827031
2-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol (PubChem CID 79827031) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol.
| Compound Name | 2-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 79827031 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 2-[(5,6-diamino-2-pyridinyl)amino]cyclohexan-1-ol |
| SMILES | Nc1ccc(NC2CCCCC2O)nc1N |
| InChI | InChI=1S/C11H18N4O/c12-7-5-6-10(15-11(7)13)14-8-3-1-2-4-9(8)16/h5-6,8-9,16H,1-4,12H2,(H3,13,14,15) |
| InChIKey | KXUMJCWSHSKINZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |