C14H16N2O — CID 99857876
trans-(1R,2R)-2-(quinolin-2-ylamino)cyclopentan-1-ol (PubChem CID 99857876) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is trans-(1R,2R)-2-(quinolin-2-ylamino)cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-(quinolin-2-ylamino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 99857876 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | trans-(1R,2R)-2-(quinolin-2-ylamino)cyclopentan-1-ol |
| SMILES | O[C@@H]1CCC[C@H]1Nc1ccc2ccccc2n1 |
| InChI | InChI=1S/C14H16N2O/c17-13-7-3-6-12(13)16-14-9-8-10-4-1-2-5-11(10)15-14/h1-2,4-5,8-9,12-13,17H,3,6-7H2,(H,15,16)/t12-,13-/m1/s1 |
| InChIKey | IQAYUXVPACNULT-CHWSQXEVSA-N |
| XLogP | 2.56 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |