C24H24N6O — CID 122438908
5-methyl-N-[(1S,2R)-2-(quinolin-2-ylamino)cyclopentyl]-2-(triazol-2-yl)benzamide (PubChem CID 122438908) has the molecular formula C24H24N6O and a molecular weight of 412.50 g/mol. Its IUPAC name is 5-methyl-N-[(1S,2R)-2-(quinolin-2-ylamino)cyclopentyl]-2-(triazol-2-yl)benzamide.
| Compound Name | 5-methyl-N-[(1S,2R)-2-(quinolin-2-ylamino)cyclopentyl]-2-(triazol-2-yl)benzamide |
|---|---|
| PubChem CID | 122438908 |
| Molecular Formula | C24H24N6O |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 5-methyl-N-[(1S,2R)-2-(quinolin-2-ylamino)cyclopentyl]-2-(triazol-2-yl)benzamide |
| SMILES | Cc1ccc(-n2nccn2)c(C(=O)N[C@H]2CCC[C@H]2Nc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C24H24N6O/c1-16-9-11-22(30-25-13-14-26-30)18(15-16)24(31)29-21-8-4-7-20(21)28-23-12-10-17-5-2-3-6-19(17)27-23/h2-3,5-6,9-15,20-21H,4,7-8H2,1H3,(H,27,28)(H,29,31)/t20-,21+/m1/s1 |
| InChIKey | WSBPEVZVXLTIAJ-RTWAWAEBSA-N |
| XLogP | 3.89 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |