C26H23N5O — CID 71522462
[5-methyl-2-(triazol-2-yl)phenyl]-[2-(2-quinolin-2-ylethynyl)piperidin-1-yl]methanone (PubChem CID 71522462) has the molecular formula C26H23N5O and a molecular weight of 421.50 g/mol. Its IUPAC name is [5-methyl-2-(triazol-2-yl)phenyl]-[2-(2-quinolin-2-ylethynyl)piperidin-1-yl]methanone.
| Compound Name | [5-methyl-2-(triazol-2-yl)phenyl]-[2-(2-quinolin-2-ylethynyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 71522462 |
| Molecular Formula | C26H23N5O |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | [5-methyl-2-(triazol-2-yl)phenyl]-[2-(2-quinolin-2-ylethynyl)piperidin-1-yl]methanone |
| SMILES | Cc1ccc(-n2nccn2)c(C(=O)N2CCCCC2C#Cc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C26H23N5O/c1-19-9-14-25(31-27-15-16-28-31)23(18-19)26(32)30-17-5-4-7-22(30)13-12-21-11-10-20-6-2-3-8-24(20)29-21/h2-3,6,8-11,14-16,18,22H,4-5,7,17H2,1H3 |
| InChIKey | PMUISDYKTRVEHW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|