C11H15BrN2O — CID 119031585
trans-(1S,2S)-2-[(5-bromo-2-pyridinyl)amino]cyclohexan-1-ol (PubChem CID 119031585) has the molecular formula C11H15BrN2O and a molecular weight of 271.16 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(5-bromo-2-pyridinyl)amino]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[(5-bromo-2-pyridinyl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 119031585 |
| Molecular Formula | C11H15BrN2O |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | trans-(1S,2S)-2-[(5-bromo-2-pyridinyl)amino]cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C11H15BrN2O/c12-8-5-6-11(13-7-8)14-9-3-1-2-4-10(9)15/h5-7,9-10,15H,1-4H2,(H,13,14)/t9-,10-/m0/s1 |
| InChIKey | KHEXWUJOTNAYID-UWVGGRQHSA-N |
| XLogP | 2.56 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |