About 5-bromo-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine
5-bromo-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine (PubChem CID 131052459) has the molecular formula C10H12BrFN2
and a molecular weight of 259.12 g/mol. Its IUPAC name is 5-bromo-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine |
| PubChem CID | 131052459 |
| Molecular Formula | C10H12BrFN2 |
| Molecular Weight | 259.12 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 5-bromo-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine |
| SMILES | F[C@@H]1CCC[C@@H]1Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C10H12BrFN2/c11-7-4-5-10(13-6-7)14-9-3-1-2-8(9)12/h4-6,8-9H,1-3H2,(H,13,14)/t8-,9+/m1/s1 |
| InChIKey | VOPIJQZMYOYYJS-BDAKNGLRSA-N |
| XLogP | 3.15 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.12 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine?
The IUPAC name of 5-bromo-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine (CID 131052459) is 5-bromo-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine.
What is the SMILES notation for 5-bromo-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine?
The canonical SMILES for 5-bromo-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine is F[C@@H]1CCC[C@@H]1Nc1ccc(Br)cn1.
What is the InChIKey of 5-bromo-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine?
The InChIKey is VOPIJQZMYOYYJS-BDAKNGLRSA-N. The full InChI is InChI=1S/C10H12BrFN2/c11-7-4-5-10(13-6-7)14-9-3-1-2-8(9)12/h4-6,8-9H,1-3H2,(H,13,14)/t8-,9+/m1/s1.
What are the key properties of 5-bromo-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine?
5-bromo-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine has a molecular weight of 259.12 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine is sourced from PubChem (CID 131052459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).