C10H12ClFN2 — CID 131160215
6-chloro-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine (PubChem CID 131160215) has the molecular formula C10H12ClFN2 and a molecular weight of 214.67 g/mol. Its IUPAC name is 6-chloro-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine.
| Compound Name | 6-chloro-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine |
|---|---|
| PubChem CID | 131160215 |
| Molecular Formula | C10H12ClFN2 |
| Molecular Weight | 214.67 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 6-chloro-N-[(1S,2R)-2-fluorocyclopentyl]pyridin-2-amine |
| SMILES | F[C@@H]1CCC[C@@H]1Nc1cccc(Cl)n1 |
| InChI | InChI=1S/C10H12ClFN2/c11-9-5-2-6-10(14-9)13-8-4-1-3-7(8)12/h2,5-8H,1,3-4H2,(H,13,14)/t7-,8+/m1/s1 |
| InChIKey | CAUQYWJYHCLOLJ-SFYZADRCSA-N |
| XLogP | 3.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.67 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|