C13H19ClN2 — CID 106662703
6-chloro-N-(2,4,4-trimethylcyclopentyl)pyridin-2-amine (PubChem CID 106662703) has the molecular formula C13H19ClN2 and a molecular weight of 238.76 g/mol. Its IUPAC name is 6-chloro-N-(2,4,4-trimethylcyclopentyl)pyridin-2-amine.
| Compound Name | 6-chloro-N-(2,4,4-trimethylcyclopentyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106662703 |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 6-chloro-N-(2,4,4-trimethylcyclopentyl)pyridin-2-amine |
| SMILES | CC1CC(C)(C)CC1Nc1cccc(Cl)n1 |
| InChI | InChI=1S/C13H19ClN2/c1-9-7-13(2,3)8-10(9)15-12-6-4-5-11(14)16-12/h4-6,9-10H,7-8H2,1-3H3,(H,15,16) |
| InChIKey | SXPJSUMIZWDTLU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|