C17H22ClN3 — CID 106662283
5-chloro-2-pyrazol-1-yl-N-(2,4,4-trimethylcyclopentyl)aniline (PubChem CID 106662283) has the molecular formula C17H22ClN3 and a molecular weight of 303.84 g/mol. Its IUPAC name is 5-chloro-2-pyrazol-1-yl-N-(2,4,4-trimethylcyclopentyl)aniline.
| Compound Name | 5-chloro-2-pyrazol-1-yl-N-(2,4,4-trimethylcyclopentyl)aniline |
|---|---|
| PubChem CID | 106662283 |
| Molecular Formula | C17H22ClN3 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 5-chloro-2-pyrazol-1-yl-N-(2,4,4-trimethylcyclopentyl)aniline |
| SMILES | CC1CC(C)(C)CC1Nc1cc(Cl)ccc1-n1cccn1 |
| InChI | InChI=1S/C17H22ClN3/c1-12-10-17(2,3)11-15(12)20-14-9-13(18)5-6-16(14)21-8-4-7-19-21/h4-9,12,15,20H,10-11H2,1-3H3 |
| InChIKey | NSQMUGDASPWDQX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |