C17H22ClN3 — CID 63449753
5-chloro-N-(4-ethylcyclohexyl)-2-pyrazol-1-ylaniline (PubChem CID 63449753) has the molecular formula C17H22ClN3 and a molecular weight of 303.84 g/mol. Its IUPAC name is 5-chloro-N-(4-ethylcyclohexyl)-2-pyrazol-1-ylaniline.
| Compound Name | 5-chloro-N-(4-ethylcyclohexyl)-2-pyrazol-1-ylaniline |
|---|---|
| PubChem CID | 63449753 |
| Molecular Formula | C17H22ClN3 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 5-chloro-N-(4-ethylcyclohexyl)-2-pyrazol-1-ylaniline |
| SMILES | CCC1CCC(Nc2cc(Cl)ccc2-n2cccn2)CC1 |
| InChI | InChI=1S/C17H22ClN3/c1-2-13-4-7-15(8-5-13)20-16-12-14(18)6-9-17(16)21-11-3-10-19-21/h3,6,9-13,15,20H,2,4-5,7-8H2,1H3 |
| InChIKey | RPZGDQZNGTUYFV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |