C16H21ClN4 — CID 79538327
5-chloro-2-pyrazol-1-yl-N-(1-pyrrolidin-2-ylpropan-2-yl)aniline (PubChem CID 79538327) has the molecular formula C16H21ClN4 and a molecular weight of 304.82 g/mol. Its IUPAC name is 5-chloro-2-pyrazol-1-yl-N-(1-pyrrolidin-2-ylpropan-2-yl)aniline.
| Compound Name | 5-chloro-2-pyrazol-1-yl-N-(1-pyrrolidin-2-ylpropan-2-yl)aniline |
|---|---|
| PubChem CID | 79538327 |
| Molecular Formula | C16H21ClN4 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 5-chloro-2-pyrazol-1-yl-N-(1-pyrrolidin-2-ylpropan-2-yl)aniline |
| SMILES | CC(CC1CCCN1)Nc1cc(Cl)ccc1-n1cccn1 |
| InChI | InChI=1S/C16H21ClN4/c1-12(10-14-4-2-7-18-14)20-15-11-13(17)5-6-16(15)21-9-3-8-19-21/h3,5-6,8-9,11-12,14,18,20H,2,4,7,10H2,1H3 |
| InChIKey | YOHYHVSPZHDJDL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |