C14H16ClN3O2S — CID 60944184
N-(5-chloro-2-pyrazol-1-ylphenyl)-1,1-dioxothian-4-amine (PubChem CID 60944184) has the molecular formula C14H16ClN3O2S and a molecular weight of 325.82 g/mol. Its IUPAC name is N-(5-chloro-2-pyrazol-1-ylphenyl)-1,1-dioxothian-4-amine.
| Compound Name | N-(5-chloro-2-pyrazol-1-ylphenyl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 60944184 |
| Molecular Formula | C14H16ClN3O2S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-(5-chloro-2-pyrazol-1-ylphenyl)-1,1-dioxothian-4-amine |
| SMILES | O=S1(=O)CCC(Nc2cc(Cl)ccc2-n2cccn2)CC1 |
| InChI | InChI=1S/C14H16ClN3O2S/c15-11-2-3-14(18-7-1-6-16-18)13(10-11)17-12-4-8-21(19,20)9-5-12/h1-3,6-7,10,12,17H,4-5,8-9H2 |
| InChIKey | OPSXUEMORWEJSF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |