C11H13BrClNO2S — CID 81264155
N-(2-bromo-4-chlorophenyl)-1,1-dioxothian-4-amine (PubChem CID 81264155) has the molecular formula C11H13BrClNO2S and a molecular weight of 338.65 g/mol. Its IUPAC name is N-(2-bromo-4-chlorophenyl)-1,1-dioxothian-4-amine.
| Compound Name | N-(2-bromo-4-chlorophenyl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 81264155 |
| Molecular Formula | C11H13BrClNO2S |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 336.95 |
| IUPAC Name | N-(2-bromo-4-chlorophenyl)-1,1-dioxothian-4-amine |
| SMILES | O=S1(=O)CCC(Nc2ccc(Cl)cc2Br)CC1 |
| InChI | InChI=1S/C11H13BrClNO2S/c12-10-7-8(13)1-2-11(10)14-9-3-5-17(15,16)6-4-9/h1-2,7,9,14H,3-6H2 |
| InChIKey | IZZGHEHMYZPGII-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |