C14H21ClN2 — CID 114049361
6-chloro-2-methyl-N-(2,4,4-trimethylcyclopentyl)pyridin-3-amine (PubChem CID 114049361) has the molecular formula C14H21ClN2 and a molecular weight of 252.79 g/mol. Its IUPAC name is 6-chloro-2-methyl-N-(2,4,4-trimethylcyclopentyl)pyridin-3-amine.
| Compound Name | 6-chloro-2-methyl-N-(2,4,4-trimethylcyclopentyl)pyridin-3-amine |
|---|---|
| PubChem CID | 114049361 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 6-chloro-2-methyl-N-(2,4,4-trimethylcyclopentyl)pyridin-3-amine |
| SMILES | Cc1nc(Cl)ccc1NC1CC(C)(C)CC1C |
| InChI | InChI=1S/C14H21ClN2/c1-9-7-14(3,4)8-12(9)17-11-5-6-13(15)16-10(11)2/h5-6,9,12,17H,7-8H2,1-4H3 |
| InChIKey | VVSFTWODSQYHFE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|