C11H13ClN2O — CID 103841267
N-(6-chloro-2-pyridinyl)-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 103841267) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is N-(6-chloro-2-pyridinyl)-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | N-(6-chloro-2-pyridinyl)-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 103841267 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | N-(6-chloro-2-pyridinyl)-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CC1(C)CC1C(=O)Nc1cccc(Cl)n1 |
| InChI | InChI=1S/C11H13ClN2O/c1-11(2)6-7(11)10(15)14-9-5-3-4-8(12)13-9/h3-5,7H,6H2,1-2H3,(H,13,14,15) |
| InChIKey | MCFLKQQQNMJXFK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|