C11H15ClN2O — CID 115669489
N-(6-chloro-2-pyridinyl)-3,3-dimethylbutanamide (PubChem CID 115669489) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is N-(6-chloro-2-pyridinyl)-3,3-dimethylbutanamide.
| Compound Name | N-(6-chloro-2-pyridinyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 115669489 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N-(6-chloro-2-pyridinyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)Nc1cccc(Cl)n1 |
| InChI | InChI=1S/C11H15ClN2O/c1-11(2,3)7-10(15)14-9-6-4-5-8(12)13-9/h4-6H,7H2,1-3H3,(H,13,14,15) |
| InChIKey | AYUBMBLVRNQXJD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|