C9H8ClF3N2O — CID 115683234
N-(6-chloro-2-pyridinyl)-4,4,4-trifluorobutanamide (PubChem CID 115683234) has the molecular formula C9H8ClF3N2O and a molecular weight of 252.62 g/mol. Its IUPAC name is N-(6-chloro-2-pyridinyl)-4,4,4-trifluorobutanamide.
| Compound Name | N-(6-chloro-2-pyridinyl)-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 115683234 |
| Molecular Formula | C9H8ClF3N2O |
| Molecular Weight | 252.62 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | N-(6-chloro-2-pyridinyl)-4,4,4-trifluorobutanamide |
| SMILES | O=C(CCC(F)(F)F)Nc1cccc(Cl)n1 |
| InChI | InChI=1S/C9H8ClF3N2O/c10-6-2-1-3-7(14-6)15-8(16)4-5-9(11,12)13/h1-3H,4-5H2,(H,14,15,16) |
| InChIKey | YWZJXSRWYPKEPL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|