C10H12ClN3O2S — CID 110181958
ethyl 2-[(6-chloro-2-pyridinyl)carbamothioylamino]acetate (PubChem CID 110181958) has the molecular formula C10H12ClN3O2S and a molecular weight of 273.75 g/mol. Its IUPAC name is ethyl 2-[(6-chloro-2-pyridinyl)carbamothioylamino]acetate.
| Compound Name | ethyl 2-[(6-chloro-2-pyridinyl)carbamothioylamino]acetate |
|---|---|
| PubChem CID | 110181958 |
| Molecular Formula | C10H12ClN3O2S |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | ethyl 2-[(6-chloro-2-pyridinyl)carbamothioylamino]acetate |
| SMILES | CCOC(=O)CNC(=S)Nc1cccc(Cl)n1 |
| InChI | InChI=1S/C10H12ClN3O2S/c1-2-16-9(15)6-12-10(17)14-8-5-3-4-7(11)13-8/h3-5H,2,6H2,1H3,(H2,12,13,14,17) |
| InChIKey | WWYDKJBIZBUHRZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|