C8H9FN2O2 — CID 45119575
ethyl N-(6-fluoro-2-pyridinyl)carbamate (PubChem CID 45119575) has the molecular formula C8H9FN2O2 and a molecular weight of 184.17 g/mol. Its IUPAC name is ethyl N-(6-fluoro-2-pyridinyl)carbamate.
| Compound Name | ethyl N-(6-fluoro-2-pyridinyl)carbamate |
|---|---|
| PubChem CID | 45119575 |
| Molecular Formula | C8H9FN2O2 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | ethyl N-(6-fluoro-2-pyridinyl)carbamate |
| SMILES | CCOC(=O)Nc1cccc(F)n1 |
| InChI | InChI=1S/C8H9FN2O2/c1-2-13-8(12)11-7-5-3-4-6(9)10-7/h3-5H,2H2,1H3,(H,10,11,12) |
| InChIKey | HLZBDOHXDHOHIY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|