C18H23N5O4 — CID 11740067
ethyl N-[6-[[6-(ethylcarbamoylamino)-2-pyridinyl]methoxymethyl]-2-pyridinyl]carbamate (PubChem CID 11740067) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is ethyl N-[6-[[6-(ethylcarbamoylamino)-2-pyridinyl]methoxymethyl]-2-pyridinyl]carbamate.
| Compound Name | ethyl N-[6-[[6-(ethylcarbamoylamino)-2-pyridinyl]methoxymethyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 11740067 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | ethyl N-[6-[[6-(ethylcarbamoylamino)-2-pyridinyl]methoxymethyl]-2-pyridinyl]carbamate |
| SMILES | CCNC(=O)Nc1cccc(COCc2cccc(NC(=O)OCC)n2)n1 |
| InChI | InChI=1S/C18H23N5O4/c1-3-19-17(24)22-15-9-5-7-13(20-15)11-26-12-14-8-6-10-16(21-14)23-18(25)27-4-2/h5-10H,3-4,11-12H2,1-2H3,(H,21,23,25)(H2,19,20,22,24) |
| InChIKey | SAJBWKWBEMMHPH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |