C10H13FN2O — CID 104820722
N-(6-fluoro-2-pyridinyl)pentanamide (PubChem CID 104820722) has the molecular formula C10H13FN2O and a molecular weight of 196.23 g/mol. Its IUPAC name is N-(6-fluoro-2-pyridinyl)pentanamide.
| Compound Name | N-(6-fluoro-2-pyridinyl)pentanamide |
|---|---|
| PubChem CID | 104820722 |
| Molecular Formula | C10H13FN2O |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | N-(6-fluoro-2-pyridinyl)pentanamide |
| SMILES | CCCCC(=O)Nc1cccc(F)n1 |
| InChI | InChI=1S/C10H13FN2O/c1-2-3-7-10(14)13-9-6-4-5-8(11)12-9/h4-6H,2-3,7H2,1H3,(H,12,13,14) |
| InChIKey | LXAIKUKILQUMHY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|