C10H12FN3O3 — CID 116813320
ethyl 2-amino-3-[(6-fluoro-2-pyridinyl)amino]-3-oxopropanoate (PubChem CID 116813320) has the molecular formula C10H12FN3O3 and a molecular weight of 241.22 g/mol. Its IUPAC name is ethyl 2-amino-3-[(6-fluoro-2-pyridinyl)amino]-3-oxopropanoate.
| Compound Name | ethyl 2-amino-3-[(6-fluoro-2-pyridinyl)amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 116813320 |
| Molecular Formula | C10H12FN3O3 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | ethyl 2-amino-3-[(6-fluoro-2-pyridinyl)amino]-3-oxopropanoate |
| SMILES | CCOC(=O)C(N)C(=O)Nc1cccc(F)n1 |
| InChI | InChI=1S/C10H12FN3O3/c1-2-17-10(16)8(12)9(15)14-7-5-3-4-6(11)13-7/h3-5,8H,2,12H2,1H3,(H,13,14,15) |
| InChIKey | VAFCQFNMILMQFS-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|