C13H19N3O2S — CID 10891292
ethyl 2-[[4-(dimethylamino)phenyl]carbamothioylamino]acetate (PubChem CID 10891292) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is ethyl 2-[[4-(dimethylamino)phenyl]carbamothioylamino]acetate.
| Compound Name | ethyl 2-[[4-(dimethylamino)phenyl]carbamothioylamino]acetate |
|---|---|
| PubChem CID | 10891292 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | ethyl 2-[[4-(dimethylamino)phenyl]carbamothioylamino]acetate |
| SMILES | CCOC(=O)CNC(=S)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C13H19N3O2S/c1-4-18-12(17)9-14-13(19)15-10-5-7-11(8-6-10)16(2)3/h5-8H,4,9H2,1-3H3,(H2,14,15,19) |
| InChIKey | HJPLJSNKBZJYQX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|