C16H25N3O2 — CID 110407235
N-[2-[4-(dimethylamino)anilino]-2-oxoethyl]-2-ethylbutanamide (PubChem CID 110407235) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)anilino]-2-oxoethyl]-2-ethylbutanamide.
| Compound Name | N-[2-[4-(dimethylamino)anilino]-2-oxoethyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 110407235 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N-[2-[4-(dimethylamino)anilino]-2-oxoethyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NCC(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C16H25N3O2/c1-5-12(6-2)16(21)17-11-15(20)18-13-7-9-14(10-8-13)19(3)4/h7-10,12H,5-6,11H2,1-4H3,(H,17,21)(H,18,20) |
| InChIKey | KJZDMYNIRPXBEW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|