C21H25N3O2 — CID 110615408
(2E)-2-benzylidene-N-[2-[4-(dimethylamino)anilino]-2-oxoethyl]butanamide (PubChem CID 110615408) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is (2E)-2-benzylidene-N-[2-[4-(dimethylamino)anilino]-2-oxoethyl]butanamide.
| Compound Name | (2E)-2-benzylidene-N-[2-[4-(dimethylamino)anilino]-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 110615408 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (2E)-2-benzylidene-N-[2-[4-(dimethylamino)anilino]-2-oxoethyl]butanamide |
| SMILES | CC/C(=C\c1ccccc1)C(=O)NCC(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H25N3O2/c1-4-17(14-16-8-6-5-7-9-16)21(26)22-15-20(25)23-18-10-12-19(13-11-18)24(2)3/h5-14H,4,15H2,1-3H3,(H,22,26)(H,23,25)/b17-14+ |
| InChIKey | BPFJHMIFMZSRDH-SAPNQHFASA-N |
| XLogP | 3.30 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|