C21H22N6O3 — CID 8000110
[2-[4-(dimethylamino)anilino]-2-oxoethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate (PubChem CID 8000110) has the molecular formula C21H22N6O3 and a molecular weight of 406.45 g/mol. Its IUPAC name is [2-[4-(dimethylamino)anilino]-2-oxoethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate.
| Compound Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 8000110 |
| Molecular Formula | C21H22N6O3 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | [2-[4-(dimethylamino)anilino]-2-oxoethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
| SMILES | Cc1nnnn1/C(=C\c1ccccc1)C(=O)OCC(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H22N6O3/c1-15-23-24-25-27(15)19(13-16-7-5-4-6-8-16)21(29)30-14-20(28)22-17-9-11-18(12-10-17)26(2)3/h4-13H,14H2,1-3H3,(H,22,28)/b19-13- |
| InChIKey | GBQDWWLECCLVDF-UYRXBGFRSA-N |
| XLogP | 2.23 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|