C25H21N5O4 — CID 29324548
[2-oxo-2-(2-phenoxyanilino)ethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate (PubChem CID 29324548) has the molecular formula C25H21N5O4 and a molecular weight of 455.47 g/mol. Its IUPAC name is [2-oxo-2-(2-phenoxyanilino)ethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate.
| Compound Name | [2-oxo-2-(2-phenoxyanilino)ethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 29324548 |
| Molecular Formula | C25H21N5O4 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | [2-oxo-2-(2-phenoxyanilino)ethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
| SMILES | Cc1nnnn1/C(=C\c1ccccc1)C(=O)OCC(=O)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C25H21N5O4/c1-18-27-28-29-30(18)22(16-19-10-4-2-5-11-19)25(32)33-17-24(31)26-21-14-8-9-15-23(21)34-20-12-6-3-7-13-20/h2-16H,17H2,1H3,(H,26,31)/b22-16- |
| InChIKey | PUCRNSLBTQASTM-JWGURIENSA-N |
| XLogP | 3.95 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|