C22H21N5O3 — CID 4600545
[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate (PubChem CID 4600545) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate.
| Compound Name | [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 4600545 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
| SMILES | Cc1nnnn1C(=Cc1ccccc1)C(=O)OCC(=O)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C22H21N5O3/c1-15-24-25-26-27(15)20(12-16-6-3-2-4-7-16)22(29)30-14-21(28)23-19-11-10-17-8-5-9-18(17)13-19/h2-4,6-7,10-13H,5,8-9,14H2,1H3,(H,23,28) |
| InChIKey | KWMPAJNMQVOPII-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|