C20H18FN5O3 — CID 8572832
[2-(2-fluoro-4-methylanilino)-2-oxoethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate (PubChem CID 8572832) has the molecular formula C20H18FN5O3 and a molecular weight of 395.39 g/mol. Its IUPAC name is [2-(2-fluoro-4-methylanilino)-2-oxoethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate.
| Compound Name | [2-(2-fluoro-4-methylanilino)-2-oxoethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 8572832 |
| Molecular Formula | C20H18FN5O3 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | [2-(2-fluoro-4-methylanilino)-2-oxoethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)/C(=C/c2ccccc2)n2nnnc2C)c(F)c1 |
| InChI | InChI=1S/C20H18FN5O3/c1-13-8-9-17(16(21)10-13)22-19(27)12-29-20(28)18(26-14(2)23-24-25-26)11-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3,(H,22,27)/b18-11- |
| InChIKey | OEWJQTRTWUNLEI-WQRHYEAKSA-N |
| XLogP | 2.61 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|