C20H19N5O3S — CID 7908942
[2-(3-methylsulfanylanilino)-2-oxoethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate (PubChem CID 7908942) has the molecular formula C20H19N5O3S and a molecular weight of 409.47 g/mol. Its IUPAC name is [2-(3-methylsulfanylanilino)-2-oxoethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate.
| Compound Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7908942 |
| Molecular Formula | C20H19N5O3S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
| SMILES | CSc1cccc(NC(=O)COC(=O)/C(=C/c2ccccc2)n2nnnc2C)c1 |
| InChI | InChI=1S/C20H19N5O3S/c1-14-22-23-24-25(14)18(11-15-7-4-3-5-8-15)20(27)28-13-19(26)21-16-9-6-10-17(12-16)29-2/h3-12H,13H2,1-2H3,(H,21,26)/b18-11- |
| InChIKey | STTUDEOSNKDGOW-WQRHYEAKSA-N |
| XLogP | 2.88 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|