C19H15FN6O5 — CID 6519339
[2-(4-fluoro-2-nitroanilino)-2-oxoethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate (PubChem CID 6519339) has the molecular formula C19H15FN6O5 and a molecular weight of 426.36 g/mol. Its IUPAC name is [2-(4-fluoro-2-nitroanilino)-2-oxoethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate.
| Compound Name | [2-(4-fluoro-2-nitroanilino)-2-oxoethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 6519339 |
| Molecular Formula | C19H15FN6O5 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | [2-(4-fluoro-2-nitroanilino)-2-oxoethyl] (Z)-2-(5-methyltetrazol-1-yl)-3-phenylprop-2-enoate |
| SMILES | Cc1nnnn1/C(=C\c1ccccc1)C(=O)OCC(=O)Nc1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H15FN6O5/c1-12-22-23-24-25(12)17(9-13-5-3-2-4-6-13)19(28)31-11-18(27)21-15-8-7-14(20)10-16(15)26(29)30/h2-10H,11H2,1H3,(H,21,27)/b17-9- |
| InChIKey | YZZWSRXIOOFTEM-MFOYZWKCSA-N |
| XLogP | 2.21 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|