C12H14ClN3O3 — CID 144586178
ethyl (Z)-3-[(6-chloro-2-pyridinyl)amino]-2-methanimidoyl-3-methoxyprop-2-enoate (PubChem CID 144586178) has the molecular formula C12H14ClN3O3 and a molecular weight of 283.72 g/mol. Its IUPAC name is ethyl (Z)-3-[(6-chloro-2-pyridinyl)amino]-2-methanimidoyl-3-methoxyprop-2-enoate.
| Compound Name | ethyl (Z)-3-[(6-chloro-2-pyridinyl)amino]-2-methanimidoyl-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 144586178 |
| Molecular Formula | C12H14ClN3O3 |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | ethyl (Z)-3-[(6-chloro-2-pyridinyl)amino]-2-methanimidoyl-3-methoxyprop-2-enoate |
| SMILES | [H]/N=C/C(C(=O)OCC)=C(\Nc1cccc(Cl)n1)OC |
| InChI | InChI=1S/C12H14ClN3O3/c1-3-19-12(17)8(7-14)11(18-2)16-10-6-4-5-9(13)15-10/h4-7,14H,3H2,1-2H3,(H,15,16)/b11-8-,14-7+ |
| InChIKey | QETQGKXFNDTVSO-CWCLOCQZSA-N |
| XLogP | 2.22 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|