C20H23N3O5 — CID 139353122
ethyl (Z)-3-ethoxy-3-[[6-(2-hydroxy-5-methoxyphenyl)-2-pyridinyl]amino]-2-methanimidoylprop-2-enoate (PubChem CID 139353122) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is ethyl (Z)-3-ethoxy-3-[[6-(2-hydroxy-5-methoxyphenyl)-2-pyridinyl]amino]-2-methanimidoylprop-2-enoate.
| Compound Name | ethyl (Z)-3-ethoxy-3-[[6-(2-hydroxy-5-methoxyphenyl)-2-pyridinyl]amino]-2-methanimidoylprop-2-enoate |
|---|---|
| PubChem CID | 139353122 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | ethyl (Z)-3-ethoxy-3-[[6-(2-hydroxy-5-methoxyphenyl)-2-pyridinyl]amino]-2-methanimidoylprop-2-enoate |
| SMILES | [H]/N=C/C(C(=O)OCC)=C(\Nc1cccc(-c2cc(OC)ccc2O)n1)OCC |
| InChI | InChI=1S/C20H23N3O5/c1-4-27-19(15(12-21)20(25)28-5-2)23-18-8-6-7-16(22-18)14-11-13(26-3)9-10-17(14)24/h6-12,21,24H,4-5H2,1-3H3,(H,22,23)/b19-15-,21-12+ |
| InChIKey | IDWPNTJPSRRYMK-GJSYAYTRSA-N |
| XLogP | 3.34 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|