C10H14ClN3O — CID 104964213
N-(5-chloropyrazin-2-yl)-3,3-dimethylbutanamide (PubChem CID 104964213) has the molecular formula C10H14ClN3O and a molecular weight of 227.69 g/mol. Its IUPAC name is N-(5-chloropyrazin-2-yl)-3,3-dimethylbutanamide.
| Compound Name | N-(5-chloropyrazin-2-yl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 104964213 |
| Molecular Formula | C10H14ClN3O |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | N-(5-chloropyrazin-2-yl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)Nc1cnc(Cl)cn1 |
| InChI | InChI=1S/C10H14ClN3O/c1-10(2,3)4-9(15)14-8-6-12-7(11)5-13-8/h5-6H,4H2,1-3H3,(H,13,14,15) |
| InChIKey | GVMOAZTUTOTMRR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |