C12H16ClN3O — CID 107595689
N-(5-chloropyrazin-2-yl)-4-methylcyclohexane-1-carboxamide (PubChem CID 107595689) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is N-(5-chloropyrazin-2-yl)-4-methylcyclohexane-1-carboxamide.
| Compound Name | N-(5-chloropyrazin-2-yl)-4-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 107595689 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | N-(5-chloropyrazin-2-yl)-4-methylcyclohexane-1-carboxamide |
| SMILES | CC1CCC(C(=O)Nc2cnc(Cl)cn2)CC1 |
| InChI | InChI=1S/C12H16ClN3O/c1-8-2-4-9(5-3-8)12(17)16-11-7-14-10(13)6-15-11/h6-9H,2-5H2,1H3,(H,15,16,17) |
| InChIKey | SGUNGAZJDZLZDE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |