About 2-chloro-N-[(1R,2S)-2-fluorocyclopentyl]-1,3-thiazol-4-amine
2-chloro-N-[(1R,2S)-2-fluorocyclopentyl]-1,3-thiazol-4-amine (PubChem CID 130654011) has the molecular formula C8H10ClFN2S
and a molecular weight of 220.70 g/mol. Its IUPAC name is 2-chloro-N-[(1R,2S)-2-fluorocyclopentyl]-1,3-thiazol-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-[(1R,2S)-2-fluorocyclopentyl]-1,3-thiazol-4-amine |
| PubChem CID | 130654011 |
| Molecular Formula | C8H10ClFN2S |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 2-chloro-N-[(1R,2S)-2-fluorocyclopentyl]-1,3-thiazol-4-amine |
| SMILES | F[C@H]1CCC[C@H]1Nc1csc(Cl)n1 |
| InChI | InChI=1S/C8H10ClFN2S/c9-8-12-7(4-13-8)11-6-3-1-2-5(6)10/h4-6,11H,1-3H2/t5-,6+/m0/s1 |
| InChIKey | ZYCYUPNKRIBAOL-NTSWFWBYSA-N |
| XLogP | 3.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-[(1R,2S)-2-fluorocyclopentyl]-1,3-thiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(1R,2S)-2-fluorocyclopentyl]-1,3-thiazol-4-amine?
The IUPAC name of 2-chloro-N-[(1R,2S)-2-fluorocyclopentyl]-1,3-thiazol-4-amine (CID 130654011) is 2-chloro-N-[(1R,2S)-2-fluorocyclopentyl]-1,3-thiazol-4-amine.
What is the SMILES notation for 2-chloro-N-[(1R,2S)-2-fluorocyclopentyl]-1,3-thiazol-4-amine?
The canonical SMILES for 2-chloro-N-[(1R,2S)-2-fluorocyclopentyl]-1,3-thiazol-4-amine is F[C@H]1CCC[C@H]1Nc1csc(Cl)n1.
What is the InChIKey of 2-chloro-N-[(1R,2S)-2-fluorocyclopentyl]-1,3-thiazol-4-amine?
The InChIKey is ZYCYUPNKRIBAOL-NTSWFWBYSA-N. The full InChI is InChI=1S/C8H10ClFN2S/c9-8-12-7(4-13-8)11-6-3-1-2-5(6)10/h4-6,11H,1-3H2/t5-,6+/m0/s1.
What are the key properties of 2-chloro-N-[(1R,2S)-2-fluorocyclopentyl]-1,3-thiazol-4-amine?
2-chloro-N-[(1R,2S)-2-fluorocyclopentyl]-1,3-thiazol-4-amine has a molecular weight of 220.70 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(1R,2S)-2-fluorocyclopentyl]-1,3-thiazol-4-amine is sourced from PubChem (CID 130654011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).