C10H13ClFN3 — CID 155905158
5-chloro-N-[(1R,2R)-2-fluorocyclohexyl]pyrimidin-2-amine (PubChem CID 155905158) has the molecular formula C10H13ClFN3 and a molecular weight of 229.69 g/mol. Its IUPAC name is 5-chloro-N-[(1R,2R)-2-fluorocyclohexyl]pyrimidin-2-amine.
| Compound Name | 5-chloro-N-[(1R,2R)-2-fluorocyclohexyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 155905158 |
| Molecular Formula | C10H13ClFN3 |
| Molecular Weight | 229.69 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 5-chloro-N-[(1R,2R)-2-fluorocyclohexyl]pyrimidin-2-amine |
| SMILES | F[C@@H]1CCCC[C@H]1Nc1ncc(Cl)cn1 |
| InChI | InChI=1S/C10H13ClFN3/c11-7-5-13-10(14-6-7)15-9-4-2-1-3-8(9)12/h5-6,8-9H,1-4H2,(H,13,14,15)/t8-,9-/m1/s1 |
| InChIKey | MPMDOMSXPXLTSE-RKDXNWHRSA-N |
| XLogP | 2.82 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.69 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |