C9H11ClFN3 — CID 126987815
5-chloro-N-[(1R,2S)-2-fluorocyclopentyl]pyrimidin-4-amine (PubChem CID 126987815) has the molecular formula C9H11ClFN3 and a molecular weight of 215.66 g/mol. Its IUPAC name is 5-chloro-N-[(1R,2S)-2-fluorocyclopentyl]pyrimidin-4-amine.
| Compound Name | 5-chloro-N-[(1R,2S)-2-fluorocyclopentyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 126987815 |
| Molecular Formula | C9H11ClFN3 |
| Molecular Weight | 215.66 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 5-chloro-N-[(1R,2S)-2-fluorocyclopentyl]pyrimidin-4-amine |
| SMILES | F[C@H]1CCC[C@H]1Nc1ncncc1Cl |
| InChI | InChI=1S/C9H11ClFN3/c10-6-4-12-5-13-9(6)14-8-3-1-2-7(8)11/h4-5,7-8H,1-3H2,(H,12,13,14)/t7-,8+/m0/s1 |
| InChIKey | SZXRCUKZLLNCST-JGVFFNPUSA-N |
| XLogP | 2.43 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.66 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |